C17H14BrClN2O3 — CID 75796236
N-(4-bromo-2-chlorophenyl)-2,6-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide (PubChem CID 75796236) has the molecular formula C17H14BrClN2O3 and a molecular weight of 409.67 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-2,6-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-(4-bromo-2-chlorophenyl)-2,6-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 75796236 |
| Molecular Formula | C17H14BrClN2O3 |
| Molecular Weight | 409.67 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-2,6-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide |
| SMILES | Cc1ccc2c(c1)NC(=O)C(C)(C(=O)Nc1ccc(Br)cc1Cl)O2 |
| InChI | InChI=1S/C17H14BrClN2O3/c1-9-3-6-14-13(7-9)21-16(23)17(2,24-14)15(22)20-12-5-4-10(18)8-11(12)19/h3-8H,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | CMVKXZZAPCLBMV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.67 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|