C12H13NO4 — CID 10944406
methyl (2R)-2,6-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxylate (PubChem CID 10944406) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is methyl (2R)-2,6-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxylate.
| Compound Name | methyl (2R)-2,6-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxylate |
|---|---|
| PubChem CID | 10944406 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | methyl (2R)-2,6-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxylate |
| SMILES | COC(=O)[C@]1(C)Oc2ccc(C)cc2NC1=O |
| InChI | InChI=1S/C12H13NO4/c1-7-4-5-9-8(6-7)13-10(14)12(2,17-9)11(15)16-3/h4-6H,1-3H3,(H,13,14)/t12-/m1/s1 |
| InChIKey | LINQPNQXWCFLNH-GFCCVEGCSA-N |
| XLogP | 1.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|