C17H15FN2O3 — CID 75796006
N-(4-fluoro-2-methylphenyl)-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide (PubChem CID 75796006) has the molecular formula C17H15FN2O3 and a molecular weight of 314.32 g/mol. Its IUPAC name is N-(4-fluoro-2-methylphenyl)-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-(4-fluoro-2-methylphenyl)-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 75796006 |
| Molecular Formula | C17H15FN2O3 |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-(4-fluoro-2-methylphenyl)-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide |
| SMILES | Cc1cc(F)ccc1NC(=O)C1(C)Oc2ccccc2NC1=O |
| InChI | InChI=1S/C17H15FN2O3/c1-10-9-11(18)7-8-12(10)19-15(21)17(2)16(22)20-13-5-3-4-6-14(13)23-17/h3-9H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | QXIGNDZZAIDBPQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|