C15H19N3O3S — CID 75770004
2-methyl-3-oxo-N-[2-oxo-2-(propan-2-ylamino)ethyl]-4H-1,4-benzothiazine-2-carboxamide (PubChem CID 75770004) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-methyl-3-oxo-N-[2-oxo-2-(propan-2-ylamino)ethyl]-4H-1,4-benzothiazine-2-carboxamide.
| Compound Name | 2-methyl-3-oxo-N-[2-oxo-2-(propan-2-ylamino)ethyl]-4H-1,4-benzothiazine-2-carboxamide |
|---|---|
| PubChem CID | 75770004 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-methyl-3-oxo-N-[2-oxo-2-(propan-2-ylamino)ethyl]-4H-1,4-benzothiazine-2-carboxamide |
| SMILES | CC(C)NC(=O)CNC(=O)C1(C)Sc2ccccc2NC1=O |
| InChI | InChI=1S/C15H19N3O3S/c1-9(2)17-12(19)8-16-13(20)15(3)14(21)18-10-6-4-5-7-11(10)22-15/h4-7,9H,8H2,1-3H3,(H,16,20)(H,17,19)(H,18,21) |
| InChIKey | UYPAJVBXEPSMNA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|