C17H15FN2O2S — CID 75797088
N-(3-fluoro-4-methylphenyl)-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxamide (PubChem CID 75797088) has the molecular formula C17H15FN2O2S and a molecular weight of 330.38 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxamide.
| Compound Name | N-(3-fluoro-4-methylphenyl)-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxamide |
|---|---|
| PubChem CID | 75797088 |
| Molecular Formula | C17H15FN2O2S |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2(C)Sc3ccccc3NC2=O)cc1F |
| InChI | InChI=1S/C17H15FN2O2S/c1-10-7-8-11(9-12(10)18)19-15(21)17(2)16(22)20-13-5-3-4-6-14(13)23-17/h3-9H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | QTAFKDWKFXOUGX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|