C18H16Cl2N2O2S — CID 75769299
N-(3,4-dichlorophenyl)-4-ethyl-2-methyl-3-oxo-1,4-benzothiazine-2-carboxamide (PubChem CID 75769299) has the molecular formula C18H16Cl2N2O2S and a molecular weight of 395.31 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-4-ethyl-2-methyl-3-oxo-1,4-benzothiazine-2-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-4-ethyl-2-methyl-3-oxo-1,4-benzothiazine-2-carboxamide |
|---|---|
| PubChem CID | 75769299 |
| Molecular Formula | C18H16Cl2N2O2S |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | N-(3,4-dichlorophenyl)-4-ethyl-2-methyl-3-oxo-1,4-benzothiazine-2-carboxamide |
| SMILES | CCN1C(=O)C(C)(C(=O)Nc2ccc(Cl)c(Cl)c2)Sc2ccccc21 |
| InChI | InChI=1S/C18H16Cl2N2O2S/c1-3-22-14-6-4-5-7-15(14)25-18(2,17(22)24)16(23)21-11-8-9-12(19)13(20)10-11/h4-10H,3H2,1-2H3,(H,21,23) |
| InChIKey | WLXKFPUUOGKXLU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|