C19H17N3O2S2 — CID 75767805
2,4-dimethyl-N-(2-methyl-1,3-benzothiazol-6-yl)-3-oxo-1,4-benzothiazine-2-carboxamide (PubChem CID 75767805) has the molecular formula C19H17N3O2S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 2,4-dimethyl-N-(2-methyl-1,3-benzothiazol-6-yl)-3-oxo-1,4-benzothiazine-2-carboxamide.
| Compound Name | 2,4-dimethyl-N-(2-methyl-1,3-benzothiazol-6-yl)-3-oxo-1,4-benzothiazine-2-carboxamide |
|---|---|
| PubChem CID | 75767805 |
| Molecular Formula | C19H17N3O2S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 2,4-dimethyl-N-(2-methyl-1,3-benzothiazol-6-yl)-3-oxo-1,4-benzothiazine-2-carboxamide |
| SMILES | Cc1nc2ccc(NC(=O)C3(C)Sc4ccccc4N(C)C3=O)cc2s1 |
| InChI | InChI=1S/C19H17N3O2S2/c1-11-20-13-9-8-12(10-16(13)25-11)21-17(23)19(2)18(24)22(3)14-6-4-5-7-15(14)26-19/h4-10H,1-3H3,(H,21,23) |
| InChIKey | OVOZFFFXXKZWPQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|