C20H19N3O3S — CID 75768290
4-ethyl-2-methyl-N-(2-methyl-1,3-benzothiazol-6-yl)-3-oxo-1,4-benzoxazine-2-carboxamide (PubChem CID 75768290) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is 4-ethyl-2-methyl-N-(2-methyl-1,3-benzothiazol-6-yl)-3-oxo-1,4-benzoxazine-2-carboxamide.
| Compound Name | 4-ethyl-2-methyl-N-(2-methyl-1,3-benzothiazol-6-yl)-3-oxo-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 75768290 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 4-ethyl-2-methyl-N-(2-methyl-1,3-benzothiazol-6-yl)-3-oxo-1,4-benzoxazine-2-carboxamide |
| SMILES | CCN1C(=O)C(C)(C(=O)Nc2ccc3nc(C)sc3c2)Oc2ccccc21 |
| InChI | InChI=1S/C20H19N3O3S/c1-4-23-15-7-5-6-8-16(15)26-20(3,19(23)25)18(24)22-13-9-10-14-17(11-13)27-12(2)21-14/h5-11H,4H2,1-3H3,(H,22,24) |
| InChIKey | DBDVXAMFNFVVOR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|