C21H18FN3O3S — CID 75769822
4-ethyl-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-methyl-3-oxo-1,4-benzoxazine-2-carboxamide (PubChem CID 75769822) has the molecular formula C21H18FN3O3S and a molecular weight of 411.46 g/mol. Its IUPAC name is 4-ethyl-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-methyl-3-oxo-1,4-benzoxazine-2-carboxamide.
| Compound Name | 4-ethyl-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-methyl-3-oxo-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 75769822 |
| Molecular Formula | C21H18FN3O3S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 4-ethyl-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-methyl-3-oxo-1,4-benzoxazine-2-carboxamide |
| SMILES | CCN1C(=O)C(C)(C(=O)Nc2nc(-c3ccc(F)cc3)cs2)Oc2ccccc21 |
| InChI | InChI=1S/C21H18FN3O3S/c1-3-25-16-6-4-5-7-17(16)28-21(2,19(25)27)18(26)24-20-23-15(12-29-20)13-8-10-14(22)11-9-13/h4-12H,3H2,1-2H3,(H,23,24,26) |
| InChIKey | UGLWLTUBZZAZGY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|