C21H18BrN3O3S — CID 75769893
N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2,4,6-trimethyl-3-oxo-1,4-benzoxazine-2-carboxamide (PubChem CID 75769893) has the molecular formula C21H18BrN3O3S and a molecular weight of 472.36 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2,4,6-trimethyl-3-oxo-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2,4,6-trimethyl-3-oxo-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 75769893 |
| Molecular Formula | C21H18BrN3O3S |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2,4,6-trimethyl-3-oxo-1,4-benzoxazine-2-carboxamide |
| SMILES | Cc1ccc2c(c1)N(C)C(=O)C(C)(C(=O)Nc1nc(-c3ccc(Br)cc3)cs1)O2 |
| InChI | InChI=1S/C21H18BrN3O3S/c1-12-4-9-17-16(10-12)25(3)19(27)21(2,28-17)18(26)24-20-23-15(11-29-20)13-5-7-14(22)8-6-13/h4-11H,1-3H3,(H,23,24,26) |
| InChIKey | UCSHARRVDSAZAW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|