C19H19FN2O2S — CID 75768064
4-ethyl-N-[(2-fluorophenyl)methyl]-2-methyl-3-oxo-1,4-benzothiazine-2-carboxamide (PubChem CID 75768064) has the molecular formula C19H19FN2O2S and a molecular weight of 358.44 g/mol. Its IUPAC name is 4-ethyl-N-[(2-fluorophenyl)methyl]-2-methyl-3-oxo-1,4-benzothiazine-2-carboxamide.
| Compound Name | 4-ethyl-N-[(2-fluorophenyl)methyl]-2-methyl-3-oxo-1,4-benzothiazine-2-carboxamide |
|---|---|
| PubChem CID | 75768064 |
| Molecular Formula | C19H19FN2O2S |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 4-ethyl-N-[(2-fluorophenyl)methyl]-2-methyl-3-oxo-1,4-benzothiazine-2-carboxamide |
| SMILES | CCN1C(=O)C(C)(C(=O)NCc2ccccc2F)Sc2ccccc21 |
| InChI | InChI=1S/C19H19FN2O2S/c1-3-22-15-10-6-7-11-16(15)25-19(2,18(22)24)17(23)21-12-13-8-4-5-9-14(13)20/h4-11H,3,12H2,1-2H3,(H,21,23) |
| InChIKey | PQCDGUGBFCOEIC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|