C24H27N3O4S — CID 75768029
2-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]-4-ethyl-2-methyl-1,4-benzothiazin-3-one (PubChem CID 75768029) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]-4-ethyl-2-methyl-1,4-benzothiazin-3-one.
| Compound Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]-4-ethyl-2-methyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 75768029 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]-4-ethyl-2-methyl-1,4-benzothiazin-3-one |
| SMILES | CCN1C(=O)C(C)(C(=O)N2CCN(Cc3ccc4c(c3)OCO4)CC2)Sc2ccccc21 |
| InChI | InChI=1S/C24H27N3O4S/c1-3-27-18-6-4-5-7-21(18)32-24(2,23(27)29)22(28)26-12-10-25(11-13-26)15-17-8-9-19-20(14-17)31-16-30-19/h4-9,14H,3,10-13,15-16H2,1-2H3 |
| InChIKey | HWICQAPSSAXWEH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|