C24H29N3O2S — CID 75768089
4-ethyl-2-methyl-2-[4-[(4-methylphenyl)methyl]piperazine-1-carbonyl]-1,4-benzothiazin-3-one (PubChem CID 75768089) has the molecular formula C24H29N3O2S and a molecular weight of 423.58 g/mol. Its IUPAC name is 4-ethyl-2-methyl-2-[4-[(4-methylphenyl)methyl]piperazine-1-carbonyl]-1,4-benzothiazin-3-one.
| Compound Name | 4-ethyl-2-methyl-2-[4-[(4-methylphenyl)methyl]piperazine-1-carbonyl]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 75768089 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 4-ethyl-2-methyl-2-[4-[(4-methylphenyl)methyl]piperazine-1-carbonyl]-1,4-benzothiazin-3-one |
| SMILES | CCN1C(=O)C(C)(C(=O)N2CCN(Cc3ccc(C)cc3)CC2)Sc2ccccc21 |
| InChI | InChI=1S/C24H29N3O2S/c1-4-27-20-7-5-6-8-21(20)30-24(3,23(27)29)22(28)26-15-13-25(14-16-26)17-19-11-9-18(2)10-12-19/h5-12H,4,13-17H2,1-3H3 |
| InChIKey | ARMZADULHYLBRT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|