C18H25N3O2S — CID 75768019
4-ethyl-2-(4-ethylpiperazine-1-carbonyl)-2-methyl-1,4-benzothiazin-3-one (PubChem CID 75768019) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is 4-ethyl-2-(4-ethylpiperazine-1-carbonyl)-2-methyl-1,4-benzothiazin-3-one.
| Compound Name | 4-ethyl-2-(4-ethylpiperazine-1-carbonyl)-2-methyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 75768019 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 4-ethyl-2-(4-ethylpiperazine-1-carbonyl)-2-methyl-1,4-benzothiazin-3-one |
| SMILES | CCN1CCN(C(=O)C2(C)Sc3ccccc3N(CC)C2=O)CC1 |
| InChI | InChI=1S/C18H25N3O2S/c1-4-19-10-12-20(13-11-19)16(22)18(3)17(23)21(5-2)14-8-6-7-9-15(14)24-18/h6-9H,4-5,10-13H2,1-3H3 |
| InChIKey | QDZSZMSLQMAEFA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|