C17H22N2O2S — CID 56686351
2-(azepane-1-carbonyl)-2,4-dimethyl-1,4-benzothiazin-3-one (PubChem CID 56686351) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is 2-(azepane-1-carbonyl)-2,4-dimethyl-1,4-benzothiazin-3-one.
| Compound Name | 2-(azepane-1-carbonyl)-2,4-dimethyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 56686351 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-(azepane-1-carbonyl)-2,4-dimethyl-1,4-benzothiazin-3-one |
| SMILES | CN1C(=O)C(C)(C(=O)N2CCCCCC2)Sc2ccccc21 |
| InChI | InChI=1S/C17H22N2O2S/c1-17(16(21)19-11-7-3-4-8-12-19)15(20)18(2)13-9-5-6-10-14(13)22-17/h5-6,9-10H,3-4,7-8,11-12H2,1-2H3 |
| InChIKey | JWLZXFATKVMKHT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|