C14H16N2O2S — CID 56686333
N-cyclopropyl-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide (PubChem CID 56686333) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is N-cyclopropyl-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide.
| Compound Name | N-cyclopropyl-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide |
|---|---|
| PubChem CID | 56686333 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | N-cyclopropyl-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide |
| SMILES | CN1C(=O)C(C)(C(=O)NC2CC2)Sc2ccccc21 |
| InChI | InChI=1S/C14H16N2O2S/c1-14(12(17)15-9-7-8-9)13(18)16(2)10-5-3-4-6-11(10)19-14/h3-6,9H,7-8H2,1-2H3,(H,15,17) |
| InChIKey | XAFUZAOTSDTAIR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|