C15H18N2O4S2 — CID 75767846
N-(1,1-dioxothiolan-3-yl)-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide (PubChem CID 75767846) has the molecular formula C15H18N2O4S2 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide |
|---|---|
| PubChem CID | 75767846 |
| Molecular Formula | C15H18N2O4S2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide |
| SMILES | CN1C(=O)C(C)(C(=O)NC2CCS(=O)(=O)C2)Sc2ccccc21 |
| InChI | InChI=1S/C15H18N2O4S2/c1-15(13(18)16-10-7-8-23(20,21)9-10)14(19)17(2)11-5-3-4-6-12(11)22-15/h3-6,10H,7-9H2,1-2H3,(H,16,18) |
| InChIKey | XAPBDHMRCKLSKG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|