C17H22N2O4S — CID 108974923
1-N'-(1,1-dioxothiolan-3-yl)-1-N-[(2-methylphenyl)methyl]cyclopropane-1,1-dicarboxamide (PubChem CID 108974923) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is 1-N'-(1,1-dioxothiolan-3-yl)-1-N-[(2-methylphenyl)methyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(1,1-dioxothiolan-3-yl)-1-N-[(2-methylphenyl)methyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108974923 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-N'-(1,1-dioxothiolan-3-yl)-1-N-[(2-methylphenyl)methyl]cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1ccccc1CNC(=O)C1(C(=O)NC2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C17H22N2O4S/c1-12-4-2-3-5-13(12)10-18-15(20)17(7-8-17)16(21)19-14-6-9-24(22,23)11-14/h2-5,14H,6-11H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | FVMVFNNLXUENBM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|