C17H22N2O4S — CID 108977960
1-N-(1,1-dioxothiolan-3-yl)-1-N'-ethyl-1-N'-phenylcyclopropane-1,1-dicarboxamide (PubChem CID 108977960) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is 1-N-(1,1-dioxothiolan-3-yl)-1-N'-ethyl-1-N'-phenylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(1,1-dioxothiolan-3-yl)-1-N'-ethyl-1-N'-phenylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108977960 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-N-(1,1-dioxothiolan-3-yl)-1-N'-ethyl-1-N'-phenylcyclopropane-1,1-dicarboxamide |
| SMILES | CCN(C(=O)C1(C(=O)NC2CCS(=O)(=O)C2)CC1)c1ccccc1 |
| InChI | InChI=1S/C17H22N2O4S/c1-2-19(14-6-4-3-5-7-14)16(21)17(9-10-17)15(20)18-13-8-11-24(22,23)12-13/h3-7,13H,2,8-12H2,1H3,(H,18,20) |
| InChIKey | YLWIRMCFMAPRAP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|