C22H26N2O2 — CID 108981840
1-N'-ethyl-1-N'-phenyl-1-N-(4-propan-2-ylphenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108981840) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 1-N'-ethyl-1-N'-phenyl-1-N-(4-propan-2-ylphenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-ethyl-1-N'-phenyl-1-N-(4-propan-2-ylphenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108981840 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 1-N'-ethyl-1-N'-phenyl-1-N-(4-propan-2-ylphenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | CCN(C(=O)C1(C(=O)Nc2ccc(C(C)C)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O2/c1-4-24(19-8-6-5-7-9-19)21(26)22(14-15-22)20(25)23-18-12-10-17(11-13-18)16(2)3/h5-13,16H,4,14-15H2,1-3H3,(H,23,25) |
| InChIKey | FMXPYVDSOCTDGR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|