C18H20N2O3 — CID 7386974
(2S)-2-(3,4-dimethoxyphenyl)-1,3-dimethyl-2H-quinazolin-4-one (PubChem CID 7386974) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is (2S)-2-(3,4-dimethoxyphenyl)-1,3-dimethyl-2H-quinazolin-4-one.
| Compound Name | (2S)-2-(3,4-dimethoxyphenyl)-1,3-dimethyl-2H-quinazolin-4-one |
|---|---|
| PubChem CID | 7386974 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (2S)-2-(3,4-dimethoxyphenyl)-1,3-dimethyl-2H-quinazolin-4-one |
| SMILES | COc1ccc([C@@H]2N(C)C(=O)c3ccccc3N2C)cc1OC |
| InChI | InChI=1S/C18H20N2O3/c1-19-14-8-6-5-7-13(14)18(21)20(2)17(19)12-9-10-15(22-3)16(11-12)23-4/h5-11,17H,1-4H3/t17-/m0/s1 |
| InChIKey | ZJUOQBHVNMIICY-KRWDZBQOSA-N |
| XLogP | 2.92 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |