About methyl 6-(1-ethoxyethenyl)-1,3,3-trimethyl-2-oxoindole-5-carboxylate
methyl 6-(1-ethoxyethenyl)-1,3,3-trimethyl-2-oxoindole-5-carboxylate (PubChem CID 167311104) has the molecular formula C17H21NO4
and a molecular weight of 303.36 g/mol. Its IUPAC name is methyl 6-(1-ethoxyethenyl)-1,3,3-trimethyl-2-oxoindole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 6-(1-ethoxyethenyl)-1,3,3-trimethyl-2-oxoindole-5-carboxylate |
| PubChem CID | 167311104 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | methyl 6-(1-ethoxyethenyl)-1,3,3-trimethyl-2-oxoindole-5-carboxylate |
| SMILES | C=C(OCC)c1cc2c(cc1C(=O)OC)C(C)(C)C(=O)N2C |
| InChI | InChI=1S/C17H21NO4/c1-7-22-10(2)11-9-14-13(8-12(11)15(19)21-6)17(3,4)16(20)18(14)5/h8-9H,2,7H2,1,3-6H3 |
| InChIKey | LKPWDYFMMASALW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-(1-ethoxyethenyl)-1,3,3-trimethyl-2-oxoindole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-(1-ethoxyethenyl)-1,3,3-trimethyl-2-oxoindole-5-carboxylate?
The IUPAC name of methyl 6-(1-ethoxyethenyl)-1,3,3-trimethyl-2-oxoindole-5-carboxylate (CID 167311104) is methyl 6-(1-ethoxyethenyl)-1,3,3-trimethyl-2-oxoindole-5-carboxylate.
What is the SMILES notation for methyl 6-(1-ethoxyethenyl)-1,3,3-trimethyl-2-oxoindole-5-carboxylate?
The canonical SMILES for methyl 6-(1-ethoxyethenyl)-1,3,3-trimethyl-2-oxoindole-5-carboxylate is C=C(OCC)c1cc2c(cc1C(=O)OC)C(C)(C)C(=O)N2C.
What is the InChIKey of methyl 6-(1-ethoxyethenyl)-1,3,3-trimethyl-2-oxoindole-5-carboxylate?
The InChIKey is LKPWDYFMMASALW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO4/c1-7-22-10(2)11-9-14-13(8-12(11)15(19)21-6)17(3,4)16(20)18(14)5/h8-9H,2,7H2,1,3-6H3.
What are the key properties of methyl 6-(1-ethoxyethenyl)-1,3,3-trimethyl-2-oxoindole-5-carboxylate?
methyl 6-(1-ethoxyethenyl)-1,3,3-trimethyl-2-oxoindole-5-carboxylate has a molecular weight of 303.36 g/mol, XLogP of 2.73, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(1-ethoxyethenyl)-1,3,3-trimethyl-2-oxoindole-5-carboxylate is sourced from PubChem (CID 167311104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).