C15H16BrNO5 — CID 169194497
6-O-ethyl 3-O-methyl 5-bromo-1,3-dimethyl-2-oxoindole-3,6-dicarboxylate (PubChem CID 169194497) has the molecular formula C15H16BrNO5 and a molecular weight of 370.20 g/mol. Its IUPAC name is 6-O-ethyl 3-O-methyl 5-bromo-1,3-dimethyl-2-oxoindole-3,6-dicarboxylate.
| Compound Name | 6-O-ethyl 3-O-methyl 5-bromo-1,3-dimethyl-2-oxoindole-3,6-dicarboxylate |
|---|---|
| PubChem CID | 169194497 |
| Molecular Formula | C15H16BrNO5 |
| Molecular Weight | 370.20 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 6-O-ethyl 3-O-methyl 5-bromo-1,3-dimethyl-2-oxoindole-3,6-dicarboxylate |
| SMILES | CCOC(=O)c1cc2c(cc1Br)C(C)(C(=O)OC)C(=O)N2C |
| InChI | InChI=1S/C15H16BrNO5/c1-5-22-12(18)8-6-11-9(7-10(8)16)15(2,14(20)21-4)13(19)17(11)3/h6-7H,5H2,1-4H3 |
| InChIKey | XWSHHTBXBHTGLC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.20 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|