C17H21NO5 — CID 167310979
methyl 5-(1-ethoxyethenyl)-3-methoxy-1,3-dimethyl-2-oxoindole-6-carboxylate (PubChem CID 167310979) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is methyl 5-(1-ethoxyethenyl)-3-methoxy-1,3-dimethyl-2-oxoindole-6-carboxylate.
| Compound Name | methyl 5-(1-ethoxyethenyl)-3-methoxy-1,3-dimethyl-2-oxoindole-6-carboxylate |
|---|---|
| PubChem CID | 167310979 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | methyl 5-(1-ethoxyethenyl)-3-methoxy-1,3-dimethyl-2-oxoindole-6-carboxylate |
| SMILES | C=C(OCC)c1cc2c(cc1C(=O)OC)N(C)C(=O)C2(C)OC |
| InChI | InChI=1S/C17H21NO5/c1-7-23-10(2)11-8-13-14(9-12(11)15(19)21-5)18(4)16(20)17(13,3)22-6/h8-9H,2,7H2,1,3-6H3 |
| InChIKey | DMYOQISXFJVPRB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|