C15H14ClN3O3 — CID 156537420
methyl 4-chloro-2,6,8-trimethyl-7-oxopyrrolo[2,3-g]quinazoline-8-carboxylate (PubChem CID 156537420) has the molecular formula C15H14ClN3O3 and a molecular weight of 319.75 g/mol. Its IUPAC name is methyl 4-chloro-2,6,8-trimethyl-7-oxopyrrolo[2,3-g]quinazoline-8-carboxylate.
| Compound Name | methyl 4-chloro-2,6,8-trimethyl-7-oxopyrrolo[2,3-g]quinazoline-8-carboxylate |
|---|---|
| PubChem CID | 156537420 |
| Molecular Formula | C15H14ClN3O3 |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | methyl 4-chloro-2,6,8-trimethyl-7-oxopyrrolo[2,3-g]quinazoline-8-carboxylate |
| SMILES | COC(=O)C1(C)C(=O)N(C)c2cc3c(Cl)nc(C)nc3cc21 |
| InChI | InChI=1S/C15H14ClN3O3/c1-7-17-10-6-9-11(5-8(10)12(16)18-7)19(3)13(20)15(9,2)14(21)22-4/h5-6H,1-4H3 |
| InChIKey | VANOHCUETMNWSQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|