C14H15N3O3 — CID 156548269
8-methoxy-2,6,8-trimethyl-3H-pyrrolo[2,3-g]quinazoline-4,7-dione (PubChem CID 156548269) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 8-methoxy-2,6,8-trimethyl-3H-pyrrolo[2,3-g]quinazoline-4,7-dione.
| Compound Name | 8-methoxy-2,6,8-trimethyl-3H-pyrrolo[2,3-g]quinazoline-4,7-dione |
|---|---|
| PubChem CID | 156548269 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 8-methoxy-2,6,8-trimethyl-3H-pyrrolo[2,3-g]quinazoline-4,7-dione |
| SMILES | COC1(C)C(=O)N(C)c2cc3c(=O)[nH]c(C)nc3cc21 |
| InChI | InChI=1S/C14H15N3O3/c1-7-15-10-6-9-11(5-8(10)12(18)16-7)17(3)13(19)14(9,2)20-4/h5-6H,1-4H3,(H,15,16,18) |
| InChIKey | CPOGRHBYALHRAS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |