C32H33F3N4O4 — CID 175812962
(8R)-4-(N-[(1R)-1-[3-[(2R)-1,1-difluoro-2,3-dihydroxy-2-methylpropyl]-2-fluorophenyl]ethyl]anilino)-8-methoxy-2,6,8-trimethylpyrrolo[2,3-g]quinazolin-7-one (PubChem CID 175812962) has the molecular formula C32H33F3N4O4 and a molecular weight of 594.63 g/mol. Its IUPAC name is (8R)-4-(N-[(1R)-1-[3-[(2R)-1,1-difluoro-2,3-dihydroxy-2-methylpropyl]-2-fluorophenyl]ethyl]anilino)-8-methoxy-2,6,8-trimethylpyrrolo[2,3-g]quinazolin-7-one.
| Compound Name | (8R)-4-(N-[(1R)-1-[3-[(2R)-1,1-difluoro-2,3-dihydroxy-2-methylpropyl]-2-fluorophenyl]ethyl]anilino)-8-methoxy-2,6,8-trimethylpyrrolo[2,3-g]quinazolin-7-one |
|---|---|
| PubChem CID | 175812962 |
| Molecular Formula | C32H33F3N4O4 |
| Molecular Weight | 594.63 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | (8R)-4-(N-[(1R)-1-[3-[(2R)-1,1-difluoro-2,3-dihydroxy-2-methylpropyl]-2-fluorophenyl]ethyl]anilino)-8-methoxy-2,6,8-trimethylpyrrolo[2,3-g]quinazolin-7-one |
| SMILES | CO[C@@]1(C)C(=O)N(C)c2cc3c(N(c4ccccc4)[C@H](C)c4cccc(C(F)(F)[C@](C)(O)CO)c4F)nc(C)nc3cc21 |
| InChI | InChI=1S/C32H33F3N4O4/c1-18(21-13-10-14-23(27(21)33)32(34,35)30(3,42)17-40)39(20-11-8-7-9-12-20)28-22-15-26-24(16-25(22)36-19(2)37-28)31(4,43-6)29(41)38(26)5/h7-16,18,40,42H,17H2,1-6H3/t18-,30-,31-/m1/s1 |
| InChIKey | SEFJDIBPZSZCEK-CPQKEUFOSA-N |
| XLogP | 5.65 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.63 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |