About methyl 5-bromo-3-methoxy-1,3-dimethyl-2-oxoindole-6-carboxylate
methyl 5-bromo-3-methoxy-1,3-dimethyl-2-oxoindole-6-carboxylate (PubChem CID 156548154) has the molecular formula C13H14BrNO4
and a molecular weight of 328.16 g/mol. Its IUPAC name is methyl 5-bromo-3-methoxy-1,3-dimethyl-2-oxoindole-6-carboxylate.
Molecular Properties
| Compound Name | methyl 5-bromo-3-methoxy-1,3-dimethyl-2-oxoindole-6-carboxylate |
| PubChem CID | 156548154 |
| Molecular Formula | C13H14BrNO4 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | methyl 5-bromo-3-methoxy-1,3-dimethyl-2-oxoindole-6-carboxylate |
| SMILES | COC(=O)c1cc2c(cc1Br)C(C)(OC)C(=O)N2C |
| InChI | InChI=1S/C13H14BrNO4/c1-13(19-4)8-6-9(14)7(11(16)18-3)5-10(8)15(2)12(13)17/h5-6H,1-4H3 |
| InChIKey | SYABDJMTQDQQCO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-bromo-3-methoxy-1,3-dimethyl-2-oxoindole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-bromo-3-methoxy-1,3-dimethyl-2-oxoindole-6-carboxylate?
The IUPAC name of methyl 5-bromo-3-methoxy-1,3-dimethyl-2-oxoindole-6-carboxylate (CID 156548154) is methyl 5-bromo-3-methoxy-1,3-dimethyl-2-oxoindole-6-carboxylate.
What is the SMILES notation for methyl 5-bromo-3-methoxy-1,3-dimethyl-2-oxoindole-6-carboxylate?
The canonical SMILES for methyl 5-bromo-3-methoxy-1,3-dimethyl-2-oxoindole-6-carboxylate is COC(=O)c1cc2c(cc1Br)C(C)(OC)C(=O)N2C.
What is the InChIKey of methyl 5-bromo-3-methoxy-1,3-dimethyl-2-oxoindole-6-carboxylate?
The InChIKey is SYABDJMTQDQQCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrNO4/c1-13(19-4)8-6-9(14)7(11(16)18-3)5-10(8)15(2)12(13)17/h5-6H,1-4H3.
What are the key properties of methyl 5-bromo-3-methoxy-1,3-dimethyl-2-oxoindole-6-carboxylate?
methyl 5-bromo-3-methoxy-1,3-dimethyl-2-oxoindole-6-carboxylate has a molecular weight of 328.16 g/mol, XLogP of 2.07, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-bromo-3-methoxy-1,3-dimethyl-2-oxoindole-6-carboxylate is sourced from PubChem (CID 156548154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).