methyl 1,3-dimethyl-3-nitrooxy-2-oxoindole-5-carboxylate

C12H12N2O6 — CID 12060505

IUPACmethyl 1,3-dimethyl-3-nitrooxy-2-oxoindole-5-carboxylate
SMILESCOC(=O)c1ccc2c(c1)C(C)(O[N+](=O)[O-])C(=O)N2C
InChIInChI=1S/C12H12N2O6/c1-12(20-14(17)18)8-6-7(10(15)19-3)4-5-9(8)13(2)11(12)16/h4-6H,1-3H3
InChIKeyBKHJRBAJRSELIL-UHFFFAOYSA-N
MW280.24 g/mol
LogP0.87
Rot. Bonds3

About methyl 1,3-dimethyl-3-nitrooxy-2-oxoindole-5-carboxylate

methyl 1,3-dimethyl-3-nitrooxy-2-oxoindole-5-carboxylate (PubChem CID 12060505) has the molecular formula C12H12N2O6 and a molecular weight of 280.24 g/mol. Its IUPAC name is methyl 1,3-dimethyl-3-nitrooxy-2-oxoindole-5-carboxylate.

Molecular Properties

Compound Namemethyl 1,3-dimethyl-3-nitrooxy-2-oxoindole-5-carboxylate
PubChem CID12060505
Molecular FormulaC12H12N2O6
Molecular Weight280.24 g/mol
Exact Mass280.07
IUPAC Namemethyl 1,3-dimethyl-3-nitrooxy-2-oxoindole-5-carboxylate
SMILESCOC(=O)c1ccc2c(c1)C(C)(O[N+](=O)[O-])C(=O)N2C
InChIInChI=1S/C12H12N2O6/c1-12(20-14(17)18)8-6-7(10(15)19-3)4-5-9(8)13(2)11(12)16/h4-6H,1-3H3
InChIKeyBKHJRBAJRSELIL-UHFFFAOYSA-N
XLogP0.87
TPSA98.98 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.24
LogP ≤ 50.87
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 1,3-dimethyl-3-nitrooxy-2-oxoindole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1,3-dimethyl-3-nitrooxy-2-oxoindole-5-carboxylate?
The IUPAC name of methyl 1,3-dimethyl-3-nitrooxy-2-oxoindole-5-carboxylate (CID 12060505) is methyl 1,3-dimethyl-3-nitrooxy-2-oxoindole-5-carboxylate.
What is the SMILES notation for methyl 1,3-dimethyl-3-nitrooxy-2-oxoindole-5-carboxylate?
The canonical SMILES for methyl 1,3-dimethyl-3-nitrooxy-2-oxoindole-5-carboxylate is COC(=O)c1ccc2c(c1)C(C)(O[N+](=O)[O-])C(=O)N2C.
What is the InChIKey of methyl 1,3-dimethyl-3-nitrooxy-2-oxoindole-5-carboxylate?
The InChIKey is BKHJRBAJRSELIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O6/c1-12(20-14(17)18)8-6-7(10(15)19-3)4-5-9(8)13(2)11(12)16/h4-6H,1-3H3.
What are the key properties of methyl 1,3-dimethyl-3-nitrooxy-2-oxoindole-5-carboxylate?
methyl 1,3-dimethyl-3-nitrooxy-2-oxoindole-5-carboxylate has a molecular weight of 280.24 g/mol, XLogP of 0.87, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1,3-dimethyl-3-nitrooxy-2-oxoindole-5-carboxylate is sourced from PubChem (CID 12060505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).