C16H20BrFN4O5 — CID 134398023
tert-butyl 3-[(5-bromo-3-nitro-2-pyridinyl)carbamoyl]-3-fluoropiperidine-1-carboxylate (PubChem CID 134398023) has the molecular formula C16H20BrFN4O5 and a molecular weight of 447.26 g/mol. Its IUPAC name is tert-butyl 3-[(5-bromo-3-nitro-2-pyridinyl)carbamoyl]-3-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(5-bromo-3-nitro-2-pyridinyl)carbamoyl]-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 134398023 |
| Molecular Formula | C16H20BrFN4O5 |
| Molecular Weight | 447.26 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | tert-butyl 3-[(5-bromo-3-nitro-2-pyridinyl)carbamoyl]-3-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(F)(C(=O)Nc2ncc(Br)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C16H20BrFN4O5/c1-15(2,3)27-14(24)21-6-4-5-16(18,9-21)13(23)20-12-11(22(25)26)7-10(17)8-19-12/h7-8H,4-6,9H2,1-3H3,(H,19,20,23) |
| InChIKey | BDPNGTYNTJKVQL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.26 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|