C15H21BrFN3O4 — CID 155729383
5-bromo-4-fluoro-2-nitroaniline;tert-butyl pyrrolidine-1-carboxylate (PubChem CID 155729383) has the molecular formula C15H21BrFN3O4 and a molecular weight of 406.25 g/mol. Its IUPAC name is 5-bromo-4-fluoro-2-nitroaniline;tert-butyl pyrrolidine-1-carboxylate.
| Compound Name | 5-bromo-4-fluoro-2-nitroaniline;tert-butyl pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 155729383 |
| Molecular Formula | C15H21BrFN3O4 |
| Molecular Weight | 406.25 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 5-bromo-4-fluoro-2-nitroaniline;tert-butyl pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1.Nc1cc(Br)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H17NO2.C6H4BrFN2O2/c1-9(2,3)12-8(11)10-6-4-5-7-10;7-3-1-5(9)6(10(11)12)2-4(3)8/h4-7H2,1-3H3;1-2H,9H2 |
| InChIKey | CBZVQBUPMGQDLP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.25 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|