C27H28BrN9O14 — CID 161307222
1-bromo-2,3-dinitrobenzene;tert-butyl 4-(2,3-dinitrophenyl)piperazine-1-carboxylate;2,3-dinitroaniline (PubChem CID 161307222) has the molecular formula C27H28BrN9O14 and a molecular weight of 782.47 g/mol. Its IUPAC name is 1-bromo-2,3-dinitrobenzene;tert-butyl 4-(2,3-dinitrophenyl)piperazine-1-carboxylate;2,3-dinitroaniline.
| Compound Name | 1-bromo-2,3-dinitrobenzene;tert-butyl 4-(2,3-dinitrophenyl)piperazine-1-carboxylate;2,3-dinitroaniline |
|---|---|
| PubChem CID | 161307222 |
| Molecular Formula | C27H28BrN9O14 |
| Molecular Weight | 782.47 g/mol |
| Exact Mass | 781.09 |
| IUPAC Name | 1-bromo-2,3-dinitrobenzene;tert-butyl 4-(2,3-dinitrophenyl)piperazine-1-carboxylate;2,3-dinitroaniline |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cccc([N+](=O)[O-])c2[N+](=O)[O-])CC1.Nc1cccc([N+](=O)[O-])c1[N+](=O)[O-].O=[N+]([O-])c1cccc(Br)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N4O6.C6H3BrN2O4.C6H5N3O4/c1-15(2,3)25-14(20)17-9-7-16(8-10-17)11-5-4-6-12(18(21)22)13(11)19(23)24;2*7-4-2-1-3-5(8(10)11)6(4)9(12)13/h4-6H,7-10H2,1-3H3;1-3H;1-3H,7H2 |
| InChIKey | VIKKWXIHNLWQJT-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 317.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|