C36H45F4N7O8 — CID 159928481
tert-butyl 4-(4-amino-3-fluorophenyl)piperazine-1-carboxylate;tert-butyl 4-(3-fluoro-4-nitrophenyl)piperazine-1-carboxylate;2,4-difluoro-1-nitrobenzene (PubChem CID 159928481) has the molecular formula C36H45F4N7O8 and a molecular weight of 779.79 g/mol. Its IUPAC name is tert-butyl 4-(4-amino-3-fluorophenyl)piperazine-1-carboxylate;tert-butyl 4-(3-fluoro-4-nitrophenyl)piperazine-1-carboxylate;2,4-difluoro-1-nitrobenzene.
| Compound Name | tert-butyl 4-(4-amino-3-fluorophenyl)piperazine-1-carboxylate;tert-butyl 4-(3-fluoro-4-nitrophenyl)piperazine-1-carboxylate;2,4-difluoro-1-nitrobenzene |
|---|---|
| PubChem CID | 159928481 |
| Molecular Formula | C36H45F4N7O8 |
| Molecular Weight | 779.79 g/mol |
| Exact Mass | 779.33 |
| IUPAC Name | tert-butyl 4-(4-amino-3-fluorophenyl)piperazine-1-carboxylate;tert-butyl 4-(3-fluoro-4-nitrophenyl)piperazine-1-carboxylate;2,4-difluoro-1-nitrobenzene |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(N)c(F)c2)CC1.CC(C)(C)OC(=O)N1CCN(c2ccc([N+](=O)[O-])c(F)c2)CC1.O=[N+]([O-])c1ccc(F)cc1F |
| InChI | InChI=1S/C15H20FN3O4.C15H22FN3O2.C6H3F2NO2/c1-15(2,3)23-14(20)18-8-6-17(7-9-18)11-4-5-13(19(21)22)12(16)10-11;1-15(2,3)21-14(20)19-8-6-18(7-9-19)11-4-5-13(17)12(16)10-11;7-4-1-2-6(9(10)11)5(8)3-4/h4-5,10H,6-9H2,1-3H3;4-5,10H,6-9,17H2,1-3H3;1-3H |
| InChIKey | NZIHMOQWJXZRKE-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 177.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.79 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|