C17H22FN3O5 — CID 113229626
tert-butyl 4-(5-fluoro-2-nitrobenzoyl)-1,4-diazepane-1-carboxylate (PubChem CID 113229626) has the molecular formula C17H22FN3O5 and a molecular weight of 367.38 g/mol. Its IUPAC name is tert-butyl 4-(5-fluoro-2-nitrobenzoyl)-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-(5-fluoro-2-nitrobenzoyl)-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 113229626 |
| Molecular Formula | C17H22FN3O5 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | tert-butyl 4-(5-fluoro-2-nitrobenzoyl)-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(C(=O)c2cc(F)ccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H22FN3O5/c1-17(2,3)26-16(23)20-8-4-7-19(9-10-20)15(22)13-11-12(18)5-6-14(13)21(24)25/h5-6,11H,4,7-10H2,1-3H3 |
| InChIKey | CXTAITPLDMMFAI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|