C19H27FN4O6 — CID 122420195
tert-butyl 4-[2-fluoro-4-[[(2S)-2-hydroxypropyl]amino]-5-nitrobenzoyl]piperazine-1-carboxylate (PubChem CID 122420195) has the molecular formula C19H27FN4O6 and a molecular weight of 426.45 g/mol. Its IUPAC name is tert-butyl 4-[2-fluoro-4-[[(2S)-2-hydroxypropyl]amino]-5-nitrobenzoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-fluoro-4-[[(2S)-2-hydroxypropyl]amino]-5-nitrobenzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 122420195 |
| Molecular Formula | C19H27FN4O6 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | tert-butyl 4-[2-fluoro-4-[[(2S)-2-hydroxypropyl]amino]-5-nitrobenzoyl]piperazine-1-carboxylate |
| SMILES | C[C@H](O)CNc1cc(F)c(C(=O)N2CCN(C(=O)OC(C)(C)C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H27FN4O6/c1-12(25)11-21-15-10-14(20)13(9-16(15)24(28)29)17(26)22-5-7-23(8-6-22)18(27)30-19(2,3)4/h9-10,12,21,25H,5-8,11H2,1-4H3/t12-/m0/s1 |
| InChIKey | PLPUPJHUMOVLSG-LBPRGKRZSA-N |
| XLogP | 2.22 |
| TPSA | 125.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|