C21H28F2N4O5 — CID 166524982
tert-butyl (3S,4S)-4-fluoro-3-[[2-fluoro-4-[[(1S,2S)-2-methylcyclopropyl]amino]-5-nitrobenzoyl]amino]piperidine-1-carboxylate (PubChem CID 166524982) has the molecular formula C21H28F2N4O5 and a molecular weight of 454.47 g/mol. Its IUPAC name is tert-butyl (3S,4S)-4-fluoro-3-[[2-fluoro-4-[[(1S,2S)-2-methylcyclopropyl]amino]-5-nitrobenzoyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-4-fluoro-3-[[2-fluoro-4-[[(1S,2S)-2-methylcyclopropyl]amino]-5-nitrobenzoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166524982 |
| Molecular Formula | C21H28F2N4O5 |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | tert-butyl (3S,4S)-4-fluoro-3-[[2-fluoro-4-[[(1S,2S)-2-methylcyclopropyl]amino]-5-nitrobenzoyl]amino]piperidine-1-carboxylate |
| SMILES | C[C@H]1C[C@@H]1Nc1cc(F)c(C(=O)N[C@H]2CN(C(=O)OC(C)(C)C)CC[C@@H]2F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H28F2N4O5/c1-11-7-15(11)24-16-9-14(23)12(8-18(16)27(30)31)19(28)25-17-10-26(6-5-13(17)22)20(29)32-21(2,3)4/h8-9,11,13,15,17,24H,5-7,10H2,1-4H3,(H,25,28)/t11-,13-,15-,17-/m0/s1 |
| InChIKey | NKQDRQLUDVYNGS-ONQXIZJVSA-N |
| XLogP | 3.63 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|