C20H26F4N4O6 — CID 166815405
tert-butyl 3-[[2-fluoro-5-nitro-4-[2-(trifluoromethoxy)ethylamino]benzoyl]amino]piperidine-1-carboxylate (PubChem CID 166815405) has the molecular formula C20H26F4N4O6 and a molecular weight of 494.44 g/mol. Its IUPAC name is tert-butyl 3-[[2-fluoro-5-nitro-4-[2-(trifluoromethoxy)ethylamino]benzoyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[2-fluoro-5-nitro-4-[2-(trifluoromethoxy)ethylamino]benzoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166815405 |
| Molecular Formula | C20H26F4N4O6 |
| Molecular Weight | 494.44 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | tert-butyl 3-[[2-fluoro-5-nitro-4-[2-(trifluoromethoxy)ethylamino]benzoyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(NC(=O)c2cc([N+](=O)[O-])c(NCCOC(F)(F)F)cc2F)C1 |
| InChI | InChI=1S/C20H26F4N4O6/c1-19(2,3)34-18(30)27-7-4-5-12(11-27)26-17(29)13-9-16(28(31)32)15(10-14(13)21)25-6-8-33-20(22,23)24/h9-10,12,25H,4-8,11H2,1-3H3,(H,26,29) |
| InChIKey | FCRAXRXBYRYVMI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|