C23H33F3N4O5 — CID 58376069
tert-butyl (3R)-3-[[4-(ethylamino)-5-nitro-2-(trifluoromethyl)benzoyl]-propan-2-ylamino]piperidine-1-carboxylate (PubChem CID 58376069) has the molecular formula C23H33F3N4O5 and a molecular weight of 502.53 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[4-(ethylamino)-5-nitro-2-(trifluoromethyl)benzoyl]-propan-2-ylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[4-(ethylamino)-5-nitro-2-(trifluoromethyl)benzoyl]-propan-2-ylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58376069 |
| Molecular Formula | C23H33F3N4O5 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | tert-butyl (3R)-3-[[4-(ethylamino)-5-nitro-2-(trifluoromethyl)benzoyl]-propan-2-ylamino]piperidine-1-carboxylate |
| SMILES | CCNc1cc(C(F)(F)F)c(C(=O)N(C(C)C)[C@@H]2CCCN(C(=O)OC(C)(C)C)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H33F3N4O5/c1-7-27-18-12-17(23(24,25)26)16(11-19(18)30(33)34)20(31)29(14(2)3)15-9-8-10-28(13-15)21(32)35-22(4,5)6/h11-12,14-15,27H,7-10,13H2,1-6H3/t15-/m1/s1 |
| InChIKey | DJHXJVREYYBLIG-OAHLLOKOSA-N |
| XLogP | 5.30 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|