C21H30ClN3O5 — CID 58376495
tert-butyl (3R)-3-[(4-chloro-2-methyl-5-nitrobenzoyl)-propan-2-ylamino]piperidine-1-carboxylate (PubChem CID 58376495) has the molecular formula C21H30ClN3O5 and a molecular weight of 439.94 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(4-chloro-2-methyl-5-nitrobenzoyl)-propan-2-ylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(4-chloro-2-methyl-5-nitrobenzoyl)-propan-2-ylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58376495 |
| Molecular Formula | C21H30ClN3O5 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | tert-butyl (3R)-3-[(4-chloro-2-methyl-5-nitrobenzoyl)-propan-2-ylamino]piperidine-1-carboxylate |
| SMILES | Cc1cc(Cl)c([N+](=O)[O-])cc1C(=O)N(C(C)C)[C@@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H30ClN3O5/c1-13(2)24(15-8-7-9-23(12-15)20(27)30-21(4,5)6)19(26)16-11-18(25(28)29)17(22)10-14(16)3/h10-11,13,15H,7-9,12H2,1-6H3/t15-/m1/s1 |
| InChIKey | SHSLPVGDBIWZCQ-OAHLLOKOSA-N |
| XLogP | 4.81 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|