C25H40N2O6 — CID 143729662
tert-butyl (3R)-3-[[4-methoxy-3-(3-methoxypropoxy)benzoyl]-propan-2-ylamino]piperidine-1-carboxylate (PubChem CID 143729662) has the molecular formula C25H40N2O6 and a molecular weight of 464.60 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[4-methoxy-3-(3-methoxypropoxy)benzoyl]-propan-2-ylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[4-methoxy-3-(3-methoxypropoxy)benzoyl]-propan-2-ylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143729662 |
| Molecular Formula | C25H40N2O6 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | tert-butyl (3R)-3-[[4-methoxy-3-(3-methoxypropoxy)benzoyl]-propan-2-ylamino]piperidine-1-carboxylate |
| SMILES | COCCCOc1cc(C(=O)N(C(C)C)[C@@H]2CCCN(C(=O)OC(C)(C)C)C2)ccc1OC |
| InChI | InChI=1S/C25H40N2O6/c1-18(2)27(20-10-8-13-26(17-20)24(29)33-25(3,4)5)23(28)19-11-12-21(31-7)22(16-19)32-15-9-14-30-6/h11-12,16,18,20H,8-10,13-15,17H2,1-7H3/t20-/m1/s1 |
| InChIKey | SUIOILXGVJPSMU-HXUWFJFHSA-N |
| XLogP | 4.36 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|