C27H44N2O6 — CID 59223963
tert-butyl (3R)-3-[[3-(3-methoxypropoxy)-4-propan-2-yloxybenzoyl]-propan-2-ylamino]piperidine-1-carboxylate (PubChem CID 59223963) has the molecular formula C27H44N2O6 and a molecular weight of 492.66 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[3-(3-methoxypropoxy)-4-propan-2-yloxybenzoyl]-propan-2-ylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[3-(3-methoxypropoxy)-4-propan-2-yloxybenzoyl]-propan-2-ylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59223963 |
| Molecular Formula | C27H44N2O6 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.32 |
| IUPAC Name | tert-butyl (3R)-3-[[3-(3-methoxypropoxy)-4-propan-2-yloxybenzoyl]-propan-2-ylamino]piperidine-1-carboxylate |
| SMILES | COCCCOc1cc(C(=O)N(C(C)C)[C@@H]2CCCN(C(=O)OC(C)(C)C)C2)ccc1OC(C)C |
| InChI | InChI=1S/C27H44N2O6/c1-19(2)29(22-11-9-14-28(18-22)26(31)35-27(5,6)7)25(30)21-12-13-23(34-20(3)4)24(17-21)33-16-10-15-32-8/h12-13,17,19-20,22H,9-11,14-16,18H2,1-8H3/t22-/m1/s1 |
| InChIKey | MGRRPNQEJXCRFT-JOCHJYFZSA-N |
| XLogP | 5.14 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|