C25H32F3N3O10 — CID 67547830
2-methyl-2-[4-[[(3R)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]-propan-2-ylcarbamoyl]-2-nitro-5-(trifluoromethyl)phenoxy]propanedioic acid (PubChem CID 67547830) has the molecular formula C25H32F3N3O10 and a molecular weight of 591.54 g/mol. Its IUPAC name is 2-methyl-2-[4-[[(3R)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]-propan-2-ylcarbamoyl]-2-nitro-5-(trifluoromethyl)phenoxy]propanedioic acid.
| Compound Name | 2-methyl-2-[4-[[(3R)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]-propan-2-ylcarbamoyl]-2-nitro-5-(trifluoromethyl)phenoxy]propanedioic acid |
|---|---|
| PubChem CID | 67547830 |
| Molecular Formula | C25H32F3N3O10 |
| Molecular Weight | 591.54 g/mol |
| Exact Mass | 591.20 |
| IUPAC Name | 2-methyl-2-[4-[[(3R)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]-propan-2-ylcarbamoyl]-2-nitro-5-(trifluoromethyl)phenoxy]propanedioic acid |
| SMILES | CC(C)N(C(=O)c1cc([N+](=O)[O-])c(OC(C)(C(=O)O)C(=O)O)cc1C(F)(F)F)[C@@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C25H32F3N3O10/c1-13(2)30(14-8-7-9-29(12-14)22(37)41-23(3,4)5)19(32)15-10-17(31(38)39)18(11-16(15)25(26,27)28)40-24(6,20(33)34)21(35)36/h10-11,13-14H,7-9,12H2,1-6H3,(H,33,34)(H,35,36)/t14-/m1/s1 |
| InChIKey | CEEUNDNTMRORNC-CQSZACIVSA-N |
| XLogP | 4.17 |
| TPSA | 176.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|