C20H26F3N3O3 — CID 58376522
N-cyclohexyl-4-(cyclopropylamino)-5-nitro-N-propan-2-yl-2-(trifluoromethyl)benzamide (PubChem CID 58376522) has the molecular formula C20H26F3N3O3 and a molecular weight of 413.44 g/mol. Its IUPAC name is N-cyclohexyl-4-(cyclopropylamino)-5-nitro-N-propan-2-yl-2-(trifluoromethyl)benzamide.
| Compound Name | N-cyclohexyl-4-(cyclopropylamino)-5-nitro-N-propan-2-yl-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58376522 |
| Molecular Formula | C20H26F3N3O3 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-cyclohexyl-4-(cyclopropylamino)-5-nitro-N-propan-2-yl-2-(trifluoromethyl)benzamide |
| SMILES | CC(C)N(C(=O)c1cc([N+](=O)[O-])c(NC2CC2)cc1C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C20H26F3N3O3/c1-12(2)25(14-6-4-3-5-7-14)19(27)15-10-18(26(28)29)17(24-13-8-9-13)11-16(15)20(21,22)23/h10-14,24H,3-9H2,1-2H3 |
| InChIKey | HUBMGXRUKVWSIP-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|