C22H31FN4O3 — CID 166815329
tert-butyl 3-[[5-amino-2-fluoro-4-(spiro[2.2]pentan-2-ylamino)benzoyl]amino]piperidine-1-carboxylate (PubChem CID 166815329) has the molecular formula C22H31FN4O3 and a molecular weight of 418.51 g/mol. Its IUPAC name is tert-butyl 3-[[5-amino-2-fluoro-4-(spiro[2.2]pentan-2-ylamino)benzoyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[5-amino-2-fluoro-4-(spiro[2.2]pentan-2-ylamino)benzoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166815329 |
| Molecular Formula | C22H31FN4O3 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | tert-butyl 3-[[5-amino-2-fluoro-4-(spiro[2.2]pentan-2-ylamino)benzoyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(NC(=O)c2cc(N)c(NC3CC34CC4)cc2F)C1 |
| InChI | InChI=1S/C22H31FN4O3/c1-21(2,3)30-20(29)27-8-4-5-13(12-27)25-19(28)14-9-16(24)17(10-15(14)23)26-18-11-22(18)6-7-22/h9-10,13,18,26H,4-8,11-12,24H2,1-3H3,(H,25,28) |
| InChIKey | DOBZAUCJRLKQHH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|