C17H23N3O3S — CID 130358457
tert-butyl (3S)-3-[(3-amino-5-ethynylthiophene-2-carbonyl)amino]piperidine-1-carboxylate (PubChem CID 130358457) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(3-amino-5-ethynylthiophene-2-carbonyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(3-amino-5-ethynylthiophene-2-carbonyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 130358457 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | tert-butyl (3S)-3-[(3-amino-5-ethynylthiophene-2-carbonyl)amino]piperidine-1-carboxylate |
| SMILES | C#Cc1cc(N)c(C(=O)N[C@H]2CCCN(C(=O)OC(C)(C)C)C2)s1 |
| InChI | InChI=1S/C17H23N3O3S/c1-5-12-9-13(18)14(24-12)15(21)19-11-7-6-8-20(10-11)16(22)23-17(2,3)4/h1,9,11H,6-8,10,18H2,2-4H3,(H,19,21)/t11-/m0/s1 |
| InChIKey | IQXQMWBORKFESX-NSHDSACASA-N |
| XLogP | 2.44 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|