C16H19BrClFN2O3 — CID 167101735
tert-butyl 4-(4-bromo-5-chloro-2-fluorobenzoyl)piperazine-1-carboxylate (PubChem CID 167101735) has the molecular formula C16H19BrClFN2O3 and a molecular weight of 421.69 g/mol. Its IUPAC name is tert-butyl 4-(4-bromo-5-chloro-2-fluorobenzoyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-bromo-5-chloro-2-fluorobenzoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 167101735 |
| Molecular Formula | C16H19BrClFN2O3 |
| Molecular Weight | 421.69 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | tert-butyl 4-(4-bromo-5-chloro-2-fluorobenzoyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)c2cc(Cl)c(Br)cc2F)CC1 |
| InChI | InChI=1S/C16H19BrClFN2O3/c1-16(2,3)24-15(23)21-6-4-20(5-7-21)14(22)10-8-12(18)11(17)9-13(10)19/h8-9H,4-7H2,1-3H3 |
| InChIKey | RSFJSOATFULVSV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.69 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|