C17H21ClF2N2O3 — CID 156753313
tert-butyl 4-(5-chloro-2,3-difluoro-4-methylbenzoyl)piperazine-1-carboxylate (PubChem CID 156753313) has the molecular formula C17H21ClF2N2O3 and a molecular weight of 374.82 g/mol. Its IUPAC name is tert-butyl 4-(5-chloro-2,3-difluoro-4-methylbenzoyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-chloro-2,3-difluoro-4-methylbenzoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 156753313 |
| Molecular Formula | C17H21ClF2N2O3 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | tert-butyl 4-(5-chloro-2,3-difluoro-4-methylbenzoyl)piperazine-1-carboxylate |
| SMILES | Cc1c(Cl)cc(C(=O)N2CCN(C(=O)OC(C)(C)C)CC2)c(F)c1F |
| InChI | InChI=1S/C17H21ClF2N2O3/c1-10-12(18)9-11(14(20)13(10)19)15(23)21-5-7-22(8-6-21)16(24)25-17(2,3)4/h9H,5-8H2,1-4H3 |
| InChIKey | DUBWWAHKGJPZQL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|