C18H22ClFN4O2 — CID 139540046
tert-butyl 4-(6-chloro-8-fluoro-7-methylquinazolin-4-yl)piperazine-1-carboxylate (PubChem CID 139540046) has the molecular formula C18H22ClFN4O2 and a molecular weight of 380.85 g/mol. Its IUPAC name is tert-butyl 4-(6-chloro-8-fluoro-7-methylquinazolin-4-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(6-chloro-8-fluoro-7-methylquinazolin-4-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 139540046 |
| Molecular Formula | C18H22ClFN4O2 |
| Molecular Weight | 380.85 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | tert-butyl 4-(6-chloro-8-fluoro-7-methylquinazolin-4-yl)piperazine-1-carboxylate |
| SMILES | Cc1c(Cl)cc2c(N3CCN(C(=O)OC(C)(C)C)CC3)ncnc2c1F |
| InChI | InChI=1S/C18H22ClFN4O2/c1-11-13(19)9-12-15(14(11)20)21-10-22-16(12)23-5-7-24(8-6-23)17(25)26-18(2,3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | KQHNLZVYAZGKKW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.85 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |