C18H21BrClFN4O3 — CID 146251151
tert-butyl 4-(7-bromo-8-chloro-6-fluoro-5-methoxyquinazolin-4-yl)piperazine-1-carboxylate (PubChem CID 146251151) has the molecular formula C18H21BrClFN4O3 and a molecular weight of 475.75 g/mol. Its IUPAC name is tert-butyl 4-(7-bromo-8-chloro-6-fluoro-5-methoxyquinazolin-4-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(7-bromo-8-chloro-6-fluoro-5-methoxyquinazolin-4-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 146251151 |
| Molecular Formula | C18H21BrClFN4O3 |
| Molecular Weight | 475.75 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | tert-butyl 4-(7-bromo-8-chloro-6-fluoro-5-methoxyquinazolin-4-yl)piperazine-1-carboxylate |
| SMILES | COc1c(F)c(Br)c(Cl)c2ncnc(N3CCN(C(=O)OC(C)(C)C)CC3)c12 |
| InChI | InChI=1S/C18H21BrClFN4O3/c1-18(2,3)28-17(26)25-7-5-24(6-8-25)16-10-14(22-9-23-16)12(20)11(19)13(21)15(10)27-4/h9H,5-8H2,1-4H3 |
| InChIKey | BDJWRHPMLADXLT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.75 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|