C17H14ClF2NO — CID 17067286
(5-chloro-2,3-difluoro-4-methylphenyl)-(3,4-dihydro-1H-isoquinolin-2-yl)methanone (PubChem CID 17067286) has the molecular formula C17H14ClF2NO and a molecular weight of 321.75 g/mol. Its IUPAC name is (5-chloro-2,3-difluoro-4-methylphenyl)-(3,4-dihydro-1H-isoquinolin-2-yl)methanone.
| Compound Name | (5-chloro-2,3-difluoro-4-methylphenyl)-(3,4-dihydro-1H-isoquinolin-2-yl)methanone |
|---|---|
| PubChem CID | 17067286 |
| Molecular Formula | C17H14ClF2NO |
| Molecular Weight | 321.75 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | (5-chloro-2,3-difluoro-4-methylphenyl)-(3,4-dihydro-1H-isoquinolin-2-yl)methanone |
| SMILES | Cc1c(Cl)cc(C(=O)N2CCc3ccccc3C2)c(F)c1F |
| InChI | InChI=1S/C17H14ClF2NO/c1-10-14(18)8-13(16(20)15(10)19)17(22)21-7-6-11-4-2-3-5-12(11)9-21/h2-5,8H,6-7,9H2,1H3 |
| InChIKey | VSTWKPOIHXVICL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.75 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|